![(2S)-4-amino-2-[(2-nitrophenyl)sulfanylamino]-4-oxobutanoic acid;N-cyclohexylcyclohexanamine (CAS: 7675-59-4) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0701053.webp "(2S)-4-amino-2-[(2-nitrophenyl)sulfanylamino]-4-oxobutanoic acid;N-cyclohexylcyclohexanamine chemical structure")
(2S)-4-amino-2-[(2-nitrophenyl)sulfanylamino]-4-oxobutanoic acid;N-cyclohexylcyclohexanamine
Catalog No: FT-0701053
CAS No: 7675-59-4
- Chemical Name: (2S)-4-amino-2-[(2-nitrophenyl)sulfanylamino]-4-oxobutanoic acid;N-cyclohexylcyclohexanamine
- Molecular Formula: C22H34N4O5S
- Molecular Weight: 466.6 g/mol
- InChI Key: VAEHYJPYTMRQNC-ZCMDIHMWSA-N
- InChI: InChI=1S/C12H23N.C10H11N3O5S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;11-9(14)5-6(10(15)16)12-19-8-4-2-1-3-7(8)13(17)18/h11-13H,1-10H2;1-4,6,12H,5H2,(H2,11,14)(H,15,16)/t;6-/m.0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | N/A |
|---|---|
| CAS: | 7675-59-4 |
| MF: | C22H34N4O5S |
| Density: | N/A |
| Melting_Point: | N/A |
| Product_Name: | (2S)-4-amino-2-[(2-nitrophenyl)sulfanylamino]-4-oxobutanoic acid,N-cyclohexylcyclohexanamine |
| Flash_Point: | N/A |
| FW: | 466.59400 |
| Exact_Mass: | 466.22500 |
|---|---|
| MF: | C22H34N4O5S |
| LogP: | 5.76680 |
| PSA: | 175.57000 |
| FW: | 466.59400 |
| WGK_Germany: | 3 |
|---|---|
| RIDADR: | NONH for all modes of transport |
